C19H27N5O2S — CID 47503100
1-[3-[[4-amino-5-[(4-propan-2-ylphenoxy)methyl]-1,2,4-triazol-3-yl]sulfanyl]propyl]pyrrolidin-2-one (PubChem CID 47503100) has the molecular formula C19H27N5O2S and a molecular weight of 389.53 g/mol. Its IUPAC name is 1-[3-[[4-amino-5-[(4-propan-2-ylphenoxy)methyl]-1,2,4-triazol-3-yl]sulfanyl]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[[4-amino-5-[(4-propan-2-ylphenoxy)methyl]-1,2,4-triazol-3-yl]sulfanyl]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 47503100 |
| Molecular Formula | C19H27N5O2S |
| Molecular Weight | 389.53 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 1-[3-[[4-amino-5-[(4-propan-2-ylphenoxy)methyl]-1,2,4-triazol-3-yl]sulfanyl]propyl]pyrrolidin-2-one |
| SMILES | CC(C)c1ccc(OCc2nnc(SCCCN3CCCC3=O)n2N)cc1 |
| InChI | InChI=1S/C19H27N5O2S/c1-14(2)15-6-8-16(9-7-15)26-13-17-21-22-19(24(17)20)27-12-4-11-23-10-3-5-18(23)25/h6-9,14H,3-5,10-13,20H2,1-2H3 |
| InChIKey | LAGYZCRHYNDENT-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.53 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|