C25H26N4O3 — CID 4750675
2-[2-(4-ethoxyphenyl)ethenyl]-5-[4-(4-methoxyphenyl)piperazin-1-yl]-1,3-oxazole-4-carbonitrile (PubChem CID 4750675) has the molecular formula C25H26N4O3 and a molecular weight of 430.51 g/mol. Its IUPAC name is 2-[2-(4-ethoxyphenyl)ethenyl]-5-[4-(4-methoxyphenyl)piperazin-1-yl]-1,3-oxazole-4-carbonitrile.
| Compound Name | 2-[2-(4-ethoxyphenyl)ethenyl]-5-[4-(4-methoxyphenyl)piperazin-1-yl]-1,3-oxazole-4-carbonitrile |
|---|---|
| PubChem CID | 4750675 |
| Molecular Formula | C25H26N4O3 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 2-[2-(4-ethoxyphenyl)ethenyl]-5-[4-(4-methoxyphenyl)piperazin-1-yl]-1,3-oxazole-4-carbonitrile |
| SMILES | CCOc1ccc(C=Cc2nc(C#N)c(N3CCN(c4ccc(OC)cc4)CC3)o2)cc1 |
| InChI | InChI=1S/C25H26N4O3/c1-3-31-22-9-4-19(5-10-22)6-13-24-27-23(18-26)25(32-24)29-16-14-28(15-17-29)20-7-11-21(30-2)12-8-20/h4-13H,3,14-17H2,1-2H3 |
| InChIKey | NZHQNUSXVLQRKC-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|