C10H20N2S — CID 47509083
1-methyl-3-[(3-methylcyclohexyl)methyl]thiourea (PubChem CID 47509083) has the molecular formula C10H20N2S and a molecular weight of 200.35 g/mol. Its IUPAC name is 1-methyl-3-[(3-methylcyclohexyl)methyl]thiourea.
| Compound Name | 1-methyl-3-[(3-methylcyclohexyl)methyl]thiourea |
|---|---|
| PubChem CID | 47509083 |
| Molecular Formula | C10H20N2S |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 1-methyl-3-[(3-methylcyclohexyl)methyl]thiourea |
| SMILES | CNC(=S)NCC1CCCC(C)C1 |
| InChI | InChI=1S/C10H20N2S/c1-8-4-3-5-9(6-8)7-12-10(13)11-2/h8-9H,3-7H2,1-2H3,(H2,11,12,13) |
| InChIKey | WQJFUVGBJGNARG-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|