About 1-(4-tert-butylphenyl)-2-[N-(5,6-dihydro-4H-1,3-thiazin-2-yl)anilino]ethanone
1-(4-tert-butylphenyl)-2-[N-(5,6-dihydro-4H-1,3-thiazin-2-yl)anilino]ethanone (PubChem CID 4751370) has the molecular formula C22H26N2OS
and a molecular weight of 366.53 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-2-[N-(5,6-dihydro-4H-1,3-thiazin-2-yl)anilino]ethanone.
Molecular Properties
| Compound Name | 1-(4-tert-butylphenyl)-2-[N-(5,6-dihydro-4H-1,3-thiazin-2-yl)anilino]ethanone |
| PubChem CID | 4751370 |
| Molecular Formula | C22H26N2OS |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 1-(4-tert-butylphenyl)-2-[N-(5,6-dihydro-4H-1,3-thiazin-2-yl)anilino]ethanone |
| SMILES | CC(C)(C)c1ccc(C(=O)CN(C2=NCCCS2)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H26N2OS/c1-22(2,3)18-12-10-17(11-13-18)20(25)16-24(19-8-5-4-6-9-19)21-23-14-7-15-26-21/h4-6,8-13H,7,14-16H2,1-3H3 |
| InChIKey | AUAGXBKKUWARAX-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4-tert-butylphenyl)-2-[N-(5,6-dihydro-4H-1,3-thiazin-2-yl)anilino]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-tert-butylphenyl)-2-[N-(5,6-dihydro-4H-1,3-thiazin-2-yl)anilino]ethanone?
The IUPAC name of 1-(4-tert-butylphenyl)-2-[N-(5,6-dihydro-4H-1,3-thiazin-2-yl)anilino]ethanone (CID 4751370) is 1-(4-tert-butylphenyl)-2-[N-(5,6-dihydro-4H-1,3-thiazin-2-yl)anilino]ethanone.
What is the SMILES notation for 1-(4-tert-butylphenyl)-2-[N-(5,6-dihydro-4H-1,3-thiazin-2-yl)anilino]ethanone?
The canonical SMILES for 1-(4-tert-butylphenyl)-2-[N-(5,6-dihydro-4H-1,3-thiazin-2-yl)anilino]ethanone is CC(C)(C)c1ccc(C(=O)CN(C2=NCCCS2)c2ccccc2)cc1.
What is the InChIKey of 1-(4-tert-butylphenyl)-2-[N-(5,6-dihydro-4H-1,3-thiazin-2-yl)anilino]ethanone?
The InChIKey is AUAGXBKKUWARAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26N2OS/c1-22(2,3)18-12-10-17(11-13-18)20(25)16-24(19-8-5-4-6-9-19)21-23-14-7-15-26-21/h4-6,8-13H,7,14-16H2,1-3H3.
What are the key properties of 1-(4-tert-butylphenyl)-2-[N-(5,6-dihydro-4H-1,3-thiazin-2-yl)anilino]ethanone?
1-(4-tert-butylphenyl)-2-[N-(5,6-dihydro-4H-1,3-thiazin-2-yl)anilino]ethanone has a molecular weight of 366.53 g/mol, XLogP of 5.17, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-tert-butylphenyl)-2-[N-(5,6-dihydro-4H-1,3-thiazin-2-yl)anilino]ethanone is sourced from PubChem (CID 4751370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).