C24H23N4O5S+ — CID 4751585
4-[[4,5-dioxo-1-(pyridin-1-ium-3-ylmethyl)-2-pyridin-3-ylpyrrolidin-3-ylidene]-hydroxymethyl]-N,N-dimethylbenzenesulfonamide (PubChem CID 4751585) has the molecular formula C24H23N4O5S+ and a molecular weight of 479.54 g/mol. Its IUPAC name is 4-[[4,5-dioxo-1-(pyridin-1-ium-3-ylmethyl)-2-pyridin-3-ylpyrrolidin-3-ylidene]-hydroxymethyl]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 4-[[4,5-dioxo-1-(pyridin-1-ium-3-ylmethyl)-2-pyridin-3-ylpyrrolidin-3-ylidene]-hydroxymethyl]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 4751585 |
| Molecular Formula | C24H23N4O5S+ |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | 4-[[4,5-dioxo-1-(pyridin-1-ium-3-ylmethyl)-2-pyridin-3-ylpyrrolidin-3-ylidene]-hydroxymethyl]-N,N-dimethylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(C(O)=C2C(=O)C(=O)N(Cc3ccc[nH+]c3)C2c2cccnc2)cc1 |
| InChI | InChI=1S/C24H22N4O5S/c1-27(2)34(32,33)19-9-7-17(8-10-19)22(29)20-21(18-6-4-12-26-14-18)28(24(31)23(20)30)15-16-5-3-11-25-13-16/h3-14,21,29H,15H2,1-2H3/p+1 |
| InChIKey | YZGVCKHQEAMICH-UHFFFAOYSA-O |
| XLogP | 1.77 |
| TPSA | 122.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|