C35H48N8O11S — CID 4752
C35H48N8O11S (PubChem CID 4752) has the molecular formula C35H48N8O11S and a molecular weight of 788.90 g/mol. Its IUPAC name is 28-(2,3-dihydroxy-2-methylpropyl)-18-hydroxy-34-(1-hydroxyethyl)-23,31-dimethyl-12-thia-10,16,22,25,27,30,33,36-octazapentacyclo[12.11.11.03,11.04,9.016,20]hexatriaconta-3(11),4,6,8-tetraene-15,21,24,26,29,32,35-heptone.
| Compound Name | C35H48N8O11S |
|---|---|
| PubChem CID | 4752 |
| Molecular Formula | C35H48N8O11S |
| Molecular Weight | 788.90 g/mol |
| Exact Mass | 788.32 |
| IUPAC Name | 28-(2,3-dihydroxy-2-methylpropyl)-18-hydroxy-34-(1-hydroxyethyl)-23,31-dimethyl-12-thia-10,16,22,25,27,30,33,36-octazapentacyclo[12.11.11.03,11.04,9.016,20]hexatriaconta-3(11),4,6,8-tetraene-15,21,24,26,29,32,35-heptone |
| SMILES | CC1C(=O)NC2CC3=C(NC4=CC=CC=C34)SCC(C(=O)N5CC(CC5C(=O)N1)O)NC(=O)C(NC(=O)C(NC(=O)C(NC2=O)CC(C)(CO)O)C)C(C)O |
| InChIKey | KPKZJLCSROULON-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 317.00 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 55 |
| Complexity | 1510 |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.90 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 12 |