C24H29F2N3O — CID 47522140
1-[3-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]propyl]pyrrolidin-2-one (PubChem CID 47522140) has the molecular formula C24H29F2N3O and a molecular weight of 413.51 g/mol. Its IUPAC name is 1-[3-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 47522140 |
| Molecular Formula | C24H29F2N3O |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.23 |
| IUPAC Name | 1-[3-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]propyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1CCCN1CCN(C(c2ccc(F)cc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C24H29F2N3O/c25-21-8-4-19(5-9-21)24(20-6-10-22(26)11-7-20)29-17-15-27(16-18-29)12-2-14-28-13-1-3-23(28)30/h4-11,24H,1-3,12-18H2 |
| InChIKey | RVGLKUCAUFJMLC-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |