About 4,5-dimethyl-2-[(4-methylsulfonylpiperazin-1-yl)methyl]-1,3-oxazole
4,5-dimethyl-2-[(4-methylsulfonylpiperazin-1-yl)methyl]-1,3-oxazole (PubChem CID 47522442) has the molecular formula C11H19N3O3S
and a molecular weight of 273.36 g/mol. Its IUPAC name is 4,5-dimethyl-2-[(4-methylsulfonylpiperazin-1-yl)methyl]-1,3-oxazole.
Molecular Properties
| Compound Name | 4,5-dimethyl-2-[(4-methylsulfonylpiperazin-1-yl)methyl]-1,3-oxazole |
| PubChem CID | 47522442 |
| Molecular Formula | C11H19N3O3S |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 4,5-dimethyl-2-[(4-methylsulfonylpiperazin-1-yl)methyl]-1,3-oxazole |
| SMILES | Cc1nc(CN2CCN(S(C)(=O)=O)CC2)oc1C |
| InChI | InChI=1S/C11H19N3O3S/c1-9-10(2)17-11(12-9)8-13-4-6-14(7-5-13)18(3,15)16/h4-8H2,1-3H3 |
| InChIKey | ZXUUFTORBUJWDT-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 66.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4,5-dimethyl-2-[(4-methylsulfonylpiperazin-1-yl)methyl]-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-2-[(4-methylsulfonylpiperazin-1-yl)methyl]-1,3-oxazole?
The IUPAC name of 4,5-dimethyl-2-[(4-methylsulfonylpiperazin-1-yl)methyl]-1,3-oxazole (CID 47522442) is 4,5-dimethyl-2-[(4-methylsulfonylpiperazin-1-yl)methyl]-1,3-oxazole.
What is the SMILES notation for 4,5-dimethyl-2-[(4-methylsulfonylpiperazin-1-yl)methyl]-1,3-oxazole?
The canonical SMILES for 4,5-dimethyl-2-[(4-methylsulfonylpiperazin-1-yl)methyl]-1,3-oxazole is Cc1nc(CN2CCN(S(C)(=O)=O)CC2)oc1C.
What is the InChIKey of 4,5-dimethyl-2-[(4-methylsulfonylpiperazin-1-yl)methyl]-1,3-oxazole?
The InChIKey is ZXUUFTORBUJWDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3O3S/c1-9-10(2)17-11(12-9)8-13-4-6-14(7-5-13)18(3,15)16/h4-8H2,1-3H3.
What are the key properties of 4,5-dimethyl-2-[(4-methylsulfonylpiperazin-1-yl)methyl]-1,3-oxazole?
4,5-dimethyl-2-[(4-methylsulfonylpiperazin-1-yl)methyl]-1,3-oxazole has a molecular weight of 273.36 g/mol, XLogP of 0.37, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-2-[(4-methylsulfonylpiperazin-1-yl)methyl]-1,3-oxazole is sourced from PubChem (CID 47522442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).