C19H22N3O2S+ — CID 4752826
2-[(6-ethoxy-1H-benzimidazol-3-ium-2-yl)sulfanyl]-N-(2-phenylethyl)acetamide (PubChem CID 4752826) has the molecular formula C19H22N3O2S+ and a molecular weight of 356.47 g/mol. Its IUPAC name is 2-[(6-ethoxy-1H-benzimidazol-3-ium-2-yl)sulfanyl]-N-(2-phenylethyl)acetamide.
| Compound Name | 2-[(6-ethoxy-1H-benzimidazol-3-ium-2-yl)sulfanyl]-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 4752826 |
| Molecular Formula | C19H22N3O2S+ |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 2-[(6-ethoxy-1H-benzimidazol-3-ium-2-yl)sulfanyl]-N-(2-phenylethyl)acetamide |
| SMILES | CCOc1ccc2[nH+]c(SCC(=O)NCCc3ccccc3)[nH]c2c1 |
| InChI | InChI=1S/C19H21N3O2S/c1-2-24-15-8-9-16-17(12-15)22-19(21-16)25-13-18(23)20-11-10-14-6-4-3-5-7-14/h3-9,12H,2,10-11,13H2,1H3,(H,20,23)(H,21,22)/p+1 |
| InChIKey | QZOCDRCMASGAMJ-UHFFFAOYSA-O |
| XLogP | 2.83 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |