C24H28N4OS2 — CID 4753001
N-cyclohexyl-2-[3-[(4-methylphenyl)sulfanylmethyl]-4-phenyl-5-sulfanylidene-1,2,4-triazol-1-yl]acetamide (PubChem CID 4753001) has the molecular formula C24H28N4OS2 and a molecular weight of 452.65 g/mol. Its IUPAC name is N-cyclohexyl-2-[3-[(4-methylphenyl)sulfanylmethyl]-4-phenyl-5-sulfanylidene-1,2,4-triazol-1-yl]acetamide.
| Compound Name | N-cyclohexyl-2-[3-[(4-methylphenyl)sulfanylmethyl]-4-phenyl-5-sulfanylidene-1,2,4-triazol-1-yl]acetamide |
|---|---|
| PubChem CID | 4753001 |
| Molecular Formula | C24H28N4OS2 |
| Molecular Weight | 452.65 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | N-cyclohexyl-2-[3-[(4-methylphenyl)sulfanylmethyl]-4-phenyl-5-sulfanylidene-1,2,4-triazol-1-yl]acetamide |
| SMILES | Cc1ccc(SCc2nn(CC(=O)NC3CCCCC3)c(=S)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H28N4OS2/c1-18-12-14-21(15-13-18)31-17-22-26-27(16-23(29)25-19-8-4-2-5-9-19)24(30)28(22)20-10-6-3-7-11-20/h3,6-7,10-15,19H,2,4-5,8-9,16-17H2,1H3,(H,25,29) |
| InChIKey | MMIHPCXSHWQNJF-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 51.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.65 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|