C25H20ClNO5S — CID 4753318
5-[[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-3-(3-hydroxyphenyl)-1,3-thiazolidine-2,4-dione (PubChem CID 4753318) has the molecular formula C25H20ClNO5S and a molecular weight of 481.96 g/mol. Its IUPAC name is 5-[[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-3-(3-hydroxyphenyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-3-(3-hydroxyphenyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 4753318 |
| Molecular Formula | C25H20ClNO5S |
| Molecular Weight | 481.96 g/mol |
| Exact Mass | 481.08 |
| IUPAC Name | 5-[[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-3-(3-hydroxyphenyl)-1,3-thiazolidine-2,4-dione |
| SMILES | CCOc1cc(C=C2SC(=O)N(c3cccc(O)c3)C2=O)ccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H20ClNO5S/c1-2-31-22-12-17(8-11-21(22)32-15-16-6-9-18(26)10-7-16)13-23-24(29)27(25(30)33-23)19-4-3-5-20(28)14-19/h3-14,28H,2,15H2,1H3 |
| InChIKey | POQQUDIFTPOANZ-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.96 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|