C21H26N4OS — CID 47535207
N-(2-cyanoethyl)-N-phenyl-2-[4-(2-thiophen-2-ylethyl)piperazin-1-yl]acetamide (PubChem CID 47535207) has the molecular formula C21H26N4OS and a molecular weight of 382.53 g/mol. Its IUPAC name is N-(2-cyanoethyl)-N-phenyl-2-[4-(2-thiophen-2-ylethyl)piperazin-1-yl]acetamide.
| Compound Name | N-(2-cyanoethyl)-N-phenyl-2-[4-(2-thiophen-2-ylethyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 47535207 |
| Molecular Formula | C21H26N4OS |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | N-(2-cyanoethyl)-N-phenyl-2-[4-(2-thiophen-2-ylethyl)piperazin-1-yl]acetamide |
| SMILES | N#CCCN(C(=O)CN1CCN(CCc2cccs2)CC1)c1ccccc1 |
| InChI | InChI=1S/C21H26N4OS/c22-10-5-11-25(19-6-2-1-3-7-19)21(26)18-24-15-13-23(14-16-24)12-9-20-8-4-17-27-20/h1-4,6-8,17H,5,9,11-16,18H2 |
| InChIKey | KBRJVXLUBFLNRC-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 50.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |