C19H22BrN2O2+ — CID 4753847
[4-[(5-bromo-2-methoxyphenyl)methyl]piperazin-4-ium-1-yl]-phenylmethanone (PubChem CID 4753847) has the molecular formula C19H22BrN2O2+ and a molecular weight of 390.30 g/mol. Its IUPAC name is [4-[(5-bromo-2-methoxyphenyl)methyl]piperazin-4-ium-1-yl]-phenylmethanone.
| Compound Name | [4-[(5-bromo-2-methoxyphenyl)methyl]piperazin-4-ium-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 4753847 |
| Molecular Formula | C19H22BrN2O2+ |
| Molecular Weight | 390.30 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | [4-[(5-bromo-2-methoxyphenyl)methyl]piperazin-4-ium-1-yl]-phenylmethanone |
| SMILES | COc1ccc(Br)cc1C[NH+]1CCN(C(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C19H21BrN2O2/c1-24-18-8-7-17(20)13-16(18)14-21-9-11-22(12-10-21)19(23)15-5-3-2-4-6-15/h2-8,13H,9-12,14H2,1H3/p+1 |
| InChIKey | HEGRZOKLHUUKRH-UHFFFAOYSA-O |
| XLogP | 2.00 |
| TPSA | 33.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.30 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |