C25H27N3O2 — CID 47543700
N,N-dimethyl-4-[[2-(2-naphthalen-1-ylpyrrolidin-1-yl)acetyl]amino]benzamide (PubChem CID 47543700) has the molecular formula C25H27N3O2 and a molecular weight of 401.51 g/mol. Its IUPAC name is N,N-dimethyl-4-[[2-(2-naphthalen-1-ylpyrrolidin-1-yl)acetyl]amino]benzamide.
| Compound Name | N,N-dimethyl-4-[[2-(2-naphthalen-1-ylpyrrolidin-1-yl)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 47543700 |
| Molecular Formula | C25H27N3O2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | N,N-dimethyl-4-[[2-(2-naphthalen-1-ylpyrrolidin-1-yl)acetyl]amino]benzamide |
| SMILES | CN(C)C(=O)c1ccc(NC(=O)CN2CCCC2c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C25H27N3O2/c1-27(2)25(30)19-12-14-20(15-13-19)26-24(29)17-28-16-6-11-23(28)22-10-5-8-18-7-3-4-9-21(18)22/h3-5,7-10,12-15,23H,6,11,16-17H2,1-2H3,(H,26,29) |
| InChIKey | TVCSLDCVLSLFHT-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |