C15H21F3N2O2S — CID 47549420
N-[1-[3-(2,2,2-trifluoroethoxy)propyl]piperidin-4-yl]thiophene-3-carboxamide (PubChem CID 47549420) has the molecular formula C15H21F3N2O2S and a molecular weight of 350.41 g/mol. Its IUPAC name is N-[1-[3-(2,2,2-trifluoroethoxy)propyl]piperidin-4-yl]thiophene-3-carboxamide.
| Compound Name | N-[1-[3-(2,2,2-trifluoroethoxy)propyl]piperidin-4-yl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 47549420 |
| Molecular Formula | C15H21F3N2O2S |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | N-[1-[3-(2,2,2-trifluoroethoxy)propyl]piperidin-4-yl]thiophene-3-carboxamide |
| SMILES | O=C(NC1CCN(CCCOCC(F)(F)F)CC1)c1ccsc1 |
| InChI | InChI=1S/C15H21F3N2O2S/c16-15(17,18)11-22-8-1-5-20-6-2-13(3-7-20)19-14(21)12-4-9-23-10-12/h4,9-10,13H,1-3,5-8,11H2,(H,19,21) |
| InChIKey | WEKMYMPYFIXDCM-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|