C22H23ClN2O4S — CID 4756263
5-(4-chlorophenyl)-1-(3-morpholin-4-ylpropyl)-4-(thiophene-2-carbonyl)pyrrolidine-2,3-dione (PubChem CID 4756263) has the molecular formula C22H23ClN2O4S and a molecular weight of 446.96 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-1-(3-morpholin-4-ylpropyl)-4-(thiophene-2-carbonyl)pyrrolidine-2,3-dione.
| Compound Name | 5-(4-chlorophenyl)-1-(3-morpholin-4-ylpropyl)-4-(thiophene-2-carbonyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 4756263 |
| Molecular Formula | C22H23ClN2O4S |
| Molecular Weight | 446.96 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | 5-(4-chlorophenyl)-1-(3-morpholin-4-ylpropyl)-4-(thiophene-2-carbonyl)pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(CCCN2CCOCC2)C(c2ccc(Cl)cc2)C1C(=O)c1cccs1 |
| InChI | InChI=1S/C22H23ClN2O4S/c23-16-6-4-15(5-7-16)19-18(20(26)17-3-1-14-30-17)21(27)22(28)25(19)9-2-8-24-10-12-29-13-11-24/h1,3-7,14,18-19H,2,8-13H2 |
| InChIKey | FCSBJSYVWSPHFQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.96 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|