C26H40N4O6S4 — CID 4756595
N-ethyl-6-[5-[3-[6-[ethyl(2-hydroxyethyl)amino]-6-oxohexyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(2-hydroxyethyl)hexanamide (PubChem CID 4756595) has the molecular formula C26H40N4O6S4 and a molecular weight of 632.90 g/mol. Its IUPAC name is N-ethyl-6-[5-[3-[6-[ethyl(2-hydroxyethyl)amino]-6-oxohexyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(2-hydroxyethyl)hexanamide.
| Compound Name | N-ethyl-6-[5-[3-[6-[ethyl(2-hydroxyethyl)amino]-6-oxohexyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(2-hydroxyethyl)hexanamide |
|---|---|
| PubChem CID | 4756595 |
| Molecular Formula | C26H40N4O6S4 |
| Molecular Weight | 632.90 g/mol |
| Exact Mass | 632.18 |
| IUPAC Name | N-ethyl-6-[5-[3-[6-[ethyl(2-hydroxyethyl)amino]-6-oxohexyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(2-hydroxyethyl)hexanamide |
| SMILES | CCN(CCO)C(=O)CCCCCN1C(=O)C(=C2SC(=S)N(CCCCCC(=O)N(CC)CCO)C2=O)SC1=S |
| InChI | InChI=1S/C26H40N4O6S4/c1-3-27(15-17-31)19(33)11-7-5-9-13-29-23(35)21(39-25(29)37)22-24(36)30(26(38)40-22)14-10-6-8-12-20(34)28(4-2)16-18-32/h31-32H,3-18H2,1-2H3 |
| InChIKey | VDHFYUCUCAVAME-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 121.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.90 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|