C22H15N3O6S2 — CID 4757107
4-[[2-[5-(1-acetyl-2-oxoindol-3-ylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]amino]benzoic acid (PubChem CID 4757107) has the molecular formula C22H15N3O6S2 and a molecular weight of 481.51 g/mol. Its IUPAC name is 4-[[2-[5-(1-acetyl-2-oxoindol-3-ylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]amino]benzoic acid.
| Compound Name | 4-[[2-[5-(1-acetyl-2-oxoindol-3-ylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 4757107 |
| Molecular Formula | C22H15N3O6S2 |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.04 |
| IUPAC Name | 4-[[2-[5-(1-acetyl-2-oxoindol-3-ylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]amino]benzoic acid |
| SMILES | CC(=O)N1C(=O)C(=C2SC(=S)N(CC(=O)Nc3ccc(C(=O)O)cc3)C2=O)c2ccccc21 |
| InChI | InChI=1S/C22H15N3O6S2/c1-11(26)25-15-5-3-2-4-14(15)17(19(25)28)18-20(29)24(22(32)33-18)10-16(27)23-13-8-6-12(7-9-13)21(30)31/h2-9H,10H2,1H3,(H,23,27)(H,30,31) |
| InChIKey | BQTVPMGJDCLWLM-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 124.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|