C18H14FN3O4 — CID 47571605
[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl] 5-acetamido-2-fluorobenzoate (PubChem CID 47571605) has the molecular formula C18H14FN3O4 and a molecular weight of 355.33 g/mol. Its IUPAC name is [4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl] 5-acetamido-2-fluorobenzoate.
| Compound Name | [4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl] 5-acetamido-2-fluorobenzoate |
|---|---|
| PubChem CID | 47571605 |
| Molecular Formula | C18H14FN3O4 |
| Molecular Weight | 355.33 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | [4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl] 5-acetamido-2-fluorobenzoate |
| SMILES | CC(=O)Nc1ccc(F)c(C(=O)Oc2ccc(-c3noc(C)n3)cc2)c1 |
| InChI | InChI=1S/C18H14FN3O4/c1-10(23)20-13-5-8-16(19)15(9-13)18(24)25-14-6-3-12(4-7-14)17-21-11(2)26-22-17/h3-9H,1-2H3,(H,20,23) |
| InChIKey | BDFCDJIKSKISKT-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.33 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|