C25H30N4O5S — CID 4757227
4-[4,5-dioxo-1-(2-piperidin-1-ylethyl)-2-pyridin-3-ylpyrrolidine-3-carbonyl]-N,N-dimethylbenzenesulfonamide (PubChem CID 4757227) has the molecular formula C25H30N4O5S and a molecular weight of 498.61 g/mol. Its IUPAC name is 4-[4,5-dioxo-1-(2-piperidin-1-ylethyl)-2-pyridin-3-ylpyrrolidine-3-carbonyl]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 4-[4,5-dioxo-1-(2-piperidin-1-ylethyl)-2-pyridin-3-ylpyrrolidine-3-carbonyl]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 4757227 |
| Molecular Formula | C25H30N4O5S |
| Molecular Weight | 498.61 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | 4-[4,5-dioxo-1-(2-piperidin-1-ylethyl)-2-pyridin-3-ylpyrrolidine-3-carbonyl]-N,N-dimethylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(C(=O)C2C(=O)C(=O)N(CCN3CCCCC3)C2c2cccnc2)cc1 |
| InChI | InChI=1S/C25H30N4O5S/c1-27(2)35(33,34)20-10-8-18(9-11-20)23(30)21-22(19-7-6-12-26-17-19)29(25(32)24(21)31)16-15-28-13-4-3-5-14-28/h6-12,17,21-22H,3-5,13-16H2,1-2H3 |
| InChIKey | IJMXWHPTKRPPQY-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 107.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.61 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|