C20H16FN3O3S2 — CID 4757305
N'-[3-[5-[(2-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoyl]benzohydrazide (PubChem CID 4757305) has the molecular formula C20H16FN3O3S2 and a molecular weight of 429.50 g/mol. Its IUPAC name is N'-[3-[5-[(2-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoyl]benzohydrazide.
| Compound Name | N'-[3-[5-[(2-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoyl]benzohydrazide |
|---|---|
| PubChem CID | 4757305 |
| Molecular Formula | C20H16FN3O3S2 |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | N'-[3-[5-[(2-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoyl]benzohydrazide |
| SMILES | O=C(CCN1C(=O)C(=Cc2ccccc2F)SC1=S)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H16FN3O3S2/c21-15-9-5-4-8-14(15)12-16-19(27)24(20(28)29-16)11-10-17(25)22-23-18(26)13-6-2-1-3-7-13/h1-9,12H,10-11H2,(H,22,25)(H,23,26) |
| InChIKey | ISNONFPVSBAUMN-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|