C27H27N2O6+ — CID 4757831
5-(2,3-dimethoxyphenyl)-4-[hydroxy-(4-methoxy-2-methylphenyl)methylidene]-1-(pyridin-1-ium-3-ylmethyl)pyrrolidine-2,3-dione (PubChem CID 4757831) has the molecular formula C27H27N2O6+ and a molecular weight of 475.52 g/mol. Its IUPAC name is 5-(2,3-dimethoxyphenyl)-4-[hydroxy-(4-methoxy-2-methylphenyl)methylidene]-1-(pyridin-1-ium-3-ylmethyl)pyrrolidine-2,3-dione.
| Compound Name | 5-(2,3-dimethoxyphenyl)-4-[hydroxy-(4-methoxy-2-methylphenyl)methylidene]-1-(pyridin-1-ium-3-ylmethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 4757831 |
| Molecular Formula | C27H27N2O6+ |
| Molecular Weight | 475.52 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | 5-(2,3-dimethoxyphenyl)-4-[hydroxy-(4-methoxy-2-methylphenyl)methylidene]-1-(pyridin-1-ium-3-ylmethyl)pyrrolidine-2,3-dione |
| SMILES | COc1ccc(C(O)=C2C(=O)C(=O)N(Cc3ccc[nH+]c3)C2c2cccc(OC)c2OC)c(C)c1 |
| InChI | InChI=1S/C27H26N2O6/c1-16-13-18(33-2)10-11-19(16)24(30)22-23(20-8-5-9-21(34-3)26(20)35-4)29(27(32)25(22)31)15-17-7-6-12-28-14-17/h5-14,23,30H,15H2,1-4H3/p+1 |
| InChIKey | OGNBIQFFDQFXLB-UHFFFAOYSA-O |
| XLogP | 3.46 |
| TPSA | 99.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.52 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|