C28H37N2O6+ — CID 4757939
3-[2-(4-hydroxy-3-methoxyphenyl)-3-[hydroxy-[2-methyl-4-(2-methylpropoxy)phenyl]methylidene]-4,5-dioxopyrrolidin-1-yl]propyl-dimethylazanium (PubChem CID 4757939) has the molecular formula C28H37N2O6+ and a molecular weight of 497.61 g/mol. Its IUPAC name is 3-[2-(4-hydroxy-3-methoxyphenyl)-3-[hydroxy-[2-methyl-4-(2-methylpropoxy)phenyl]methylidene]-4,5-dioxopyrrolidin-1-yl]propyl-dimethylazanium.
| Compound Name | 3-[2-(4-hydroxy-3-methoxyphenyl)-3-[hydroxy-[2-methyl-4-(2-methylpropoxy)phenyl]methylidene]-4,5-dioxopyrrolidin-1-yl]propyl-dimethylazanium |
|---|---|
| PubChem CID | 4757939 |
| Molecular Formula | C28H37N2O6+ |
| Molecular Weight | 497.61 g/mol |
| Exact Mass | 497.26 |
| IUPAC Name | 3-[2-(4-hydroxy-3-methoxyphenyl)-3-[hydroxy-[2-methyl-4-(2-methylpropoxy)phenyl]methylidene]-4,5-dioxopyrrolidin-1-yl]propyl-dimethylazanium |
| SMILES | COc1cc(C2C(=C(O)c3ccc(OCC(C)C)cc3C)C(=O)C(=O)N2CCC[NH+](C)C)ccc1O |
| InChI | InChI=1S/C28H36N2O6/c1-17(2)16-36-20-9-10-21(18(3)14-20)26(32)24-25(19-8-11-22(31)23(15-19)35-6)30(28(34)27(24)33)13-7-12-29(4)5/h8-11,14-15,17,25,31-32H,7,12-13,16H2,1-6H3/p+1 |
| InChIKey | IATJVRWGECGLHI-UHFFFAOYSA-O |
| XLogP | 2.70 |
| TPSA | 100.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.61 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|