C26H31N2O5+ — CID 4758320
4-[hydroxy-(4-methoxy-3-methylphenyl)methylidene]-1-(3-morpholin-4-ium-4-ylpropyl)-5-phenylpyrrolidine-2,3-dione (PubChem CID 4758320) has the molecular formula C26H31N2O5+ and a molecular weight of 451.54 g/mol. Its IUPAC name is 4-[hydroxy-(4-methoxy-3-methylphenyl)methylidene]-1-(3-morpholin-4-ium-4-ylpropyl)-5-phenylpyrrolidine-2,3-dione.
| Compound Name | 4-[hydroxy-(4-methoxy-3-methylphenyl)methylidene]-1-(3-morpholin-4-ium-4-ylpropyl)-5-phenylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 4758320 |
| Molecular Formula | C26H31N2O5+ |
| Molecular Weight | 451.54 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | 4-[hydroxy-(4-methoxy-3-methylphenyl)methylidene]-1-(3-morpholin-4-ium-4-ylpropyl)-5-phenylpyrrolidine-2,3-dione |
| SMILES | COc1ccc(C(O)=C2C(=O)C(=O)N(CCC[NH+]3CCOCC3)C2c2ccccc2)cc1C |
| InChI | InChI=1S/C26H30N2O5/c1-18-17-20(9-10-21(18)32-2)24(29)22-23(19-7-4-3-5-8-19)28(26(31)25(22)30)12-6-11-27-13-15-33-16-14-27/h3-5,7-10,17,23,29H,6,11-16H2,1-2H3/p+1 |
| InChIKey | SNDGNSKURRRQCY-UHFFFAOYSA-O |
| XLogP | 1.73 |
| TPSA | 80.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.54 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|