C16H16ClNO4S — CID 47583628
[4-(methanesulfonamido)phenyl] 3-(3-chlorophenyl)propanoate (PubChem CID 47583628) has the molecular formula C16H16ClNO4S and a molecular weight of 353.83 g/mol. Its IUPAC name is [4-(methanesulfonamido)phenyl] 3-(3-chlorophenyl)propanoate.
| Compound Name | [4-(methanesulfonamido)phenyl] 3-(3-chlorophenyl)propanoate |
|---|---|
| PubChem CID | 47583628 |
| Molecular Formula | C16H16ClNO4S |
| Molecular Weight | 353.83 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | [4-(methanesulfonamido)phenyl] 3-(3-chlorophenyl)propanoate |
| SMILES | CS(=O)(=O)Nc1ccc(OC(=O)CCc2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C16H16ClNO4S/c1-23(20,21)18-14-6-8-15(9-7-14)22-16(19)10-5-12-3-2-4-13(17)11-12/h2-4,6-9,11,18H,5,10H2,1H3 |
| InChIKey | YQQOFMUZSSMYIL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.83 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|