C23H21N5O3 — CID 47585209
2-(pyridine-4-carbonylamino)ethyl 1-ethyl-6-phenylpyrazolo[5,4-b]pyridine-4-carboxylate (PubChem CID 47585209) has the molecular formula C23H21N5O3 and a molecular weight of 415.45 g/mol. Its IUPAC name is 2-(pyridine-4-carbonylamino)ethyl 1-ethyl-6-phenylpyrazolo[5,4-b]pyridine-4-carboxylate.
| Compound Name | 2-(pyridine-4-carbonylamino)ethyl 1-ethyl-6-phenylpyrazolo[5,4-b]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 47585209 |
| Molecular Formula | C23H21N5O3 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 2-(pyridine-4-carbonylamino)ethyl 1-ethyl-6-phenylpyrazolo[5,4-b]pyridine-4-carboxylate |
| SMILES | CCn1ncc2c(C(=O)OCCNC(=O)c3ccncc3)cc(-c3ccccc3)nc21 |
| InChI | InChI=1S/C23H21N5O3/c1-2-28-21-19(15-26-28)18(14-20(27-21)16-6-4-3-5-7-16)23(30)31-13-12-25-22(29)17-8-10-24-11-9-17/h3-11,14-15H,2,12-13H2,1H3,(H,25,29) |
| InChIKey | VDUXDIRQNPNFCG-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|