C18H23NO4 — CID 47589092
[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl 3-(furan-3-carbonylamino)propanoate (PubChem CID 47589092) has the molecular formula C18H23NO4 and a molecular weight of 317.38 g/mol. Its IUPAC name is [(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl 3-(furan-3-carbonylamino)propanoate.
| Compound Name | [(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl 3-(furan-3-carbonylamino)propanoate |
|---|---|
| PubChem CID | 47589092 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | [(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl 3-(furan-3-carbonylamino)propanoate |
| SMILES | CC1(C)[C@H]2CC=C(COC(=O)CCNC(=O)c3ccoc3)[C@@H]1C2 |
| InChI | InChI=1S/C18H23NO4/c1-18(2)14-4-3-12(15(18)9-14)11-23-16(20)5-7-19-17(21)13-6-8-22-10-13/h3,6,8,10,14-15H,4-5,7,9,11H2,1-2H3,(H,19,21)/t14-,15-/m0/s1 |
| InChIKey | ZXEPFORKGHXONH-GJZGRUSLSA-N |
| XLogP | 2.94 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|