C24H31N3O5S2 — CID 4759114
ethyl 4-[6-[5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoyl]piperazine-1-carboxylate (PubChem CID 4759114) has the molecular formula C24H31N3O5S2 and a molecular weight of 505.66 g/mol. Its IUPAC name is ethyl 4-[6-[5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[6-[5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 4759114 |
| Molecular Formula | C24H31N3O5S2 |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.17 |
| IUPAC Name | ethyl 4-[6-[5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)CCCCCN2C(=O)C(=Cc3ccc(OC)cc3)SC2=S)CC1 |
| InChI | InChI=1S/C24H31N3O5S2/c1-3-32-23(30)26-15-13-25(14-16-26)21(28)7-5-4-6-12-27-22(29)20(34-24(27)33)17-18-8-10-19(31-2)11-9-18/h8-11,17H,3-7,12-16H2,1-2H3 |
| InChIKey | DGGSFVGSSABWBR-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|