About [4-(ethylcarbamoylamino)cyclohexyl] 2,4-difluorobenzoate
[4-(ethylcarbamoylamino)cyclohexyl] 2,4-difluorobenzoate (PubChem CID 47592201) has the molecular formula C16H20F2N2O3
and a molecular weight of 326.34 g/mol. Its IUPAC name is [4-(ethylcarbamoylamino)cyclohexyl] 2,4-difluorobenzoate.
Molecular Properties
| Compound Name | [4-(ethylcarbamoylamino)cyclohexyl] 2,4-difluorobenzoate |
| PubChem CID | 47592201 |
| Molecular Formula | C16H20F2N2O3 |
| Molecular Weight | 326.34 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | [4-(ethylcarbamoylamino)cyclohexyl] 2,4-difluorobenzoate |
| SMILES | CCNC(=O)NC1CCC(OC(=O)c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C16H20F2N2O3/c1-2-19-16(22)20-11-4-6-12(7-5-11)23-15(21)13-8-3-10(17)9-14(13)18/h3,8-9,11-12H,2,4-7H2,1H3,(H2,19,20,22) |
| InChIKey | YVVPBAXVLLMBFM-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.34 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-(ethylcarbamoylamino)cyclohexyl] 2,4-difluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(ethylcarbamoylamino)cyclohexyl] 2,4-difluorobenzoate?
The IUPAC name of [4-(ethylcarbamoylamino)cyclohexyl] 2,4-difluorobenzoate (CID 47592201) is [4-(ethylcarbamoylamino)cyclohexyl] 2,4-difluorobenzoate.
What is the SMILES notation for [4-(ethylcarbamoylamino)cyclohexyl] 2,4-difluorobenzoate?
The canonical SMILES for [4-(ethylcarbamoylamino)cyclohexyl] 2,4-difluorobenzoate is CCNC(=O)NC1CCC(OC(=O)c2ccc(F)cc2F)CC1.
What is the InChIKey of [4-(ethylcarbamoylamino)cyclohexyl] 2,4-difluorobenzoate?
The InChIKey is YVVPBAXVLLMBFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20F2N2O3/c1-2-19-16(22)20-11-4-6-12(7-5-11)23-15(21)13-8-3-10(17)9-14(13)18/h3,8-9,11-12H,2,4-7H2,1H3,(H2,19,20,22).
What are the key properties of [4-(ethylcarbamoylamino)cyclohexyl] 2,4-difluorobenzoate?
[4-(ethylcarbamoylamino)cyclohexyl] 2,4-difluorobenzoate has a molecular weight of 326.34 g/mol, XLogP of 2.75, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(ethylcarbamoylamino)cyclohexyl] 2,4-difluorobenzoate is sourced from PubChem (CID 47592201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).