C22H33N5 — CID 47611144
1-(1-methyl-3-pyridin-3-ylpyrazol-4-yl)-N-[(1-piperidin-1-ylcyclohexyl)methyl]methanamine (PubChem CID 47611144) has the molecular formula C22H33N5 and a molecular weight of 367.54 g/mol. Its IUPAC name is 1-(1-methyl-3-pyridin-3-ylpyrazol-4-yl)-N-[(1-piperidin-1-ylcyclohexyl)methyl]methanamine.
| Compound Name | 1-(1-methyl-3-pyridin-3-ylpyrazol-4-yl)-N-[(1-piperidin-1-ylcyclohexyl)methyl]methanamine |
|---|---|
| PubChem CID | 47611144 |
| Molecular Formula | C22H33N5 |
| Molecular Weight | 367.54 g/mol |
| Exact Mass | 367.27 |
| IUPAC Name | 1-(1-methyl-3-pyridin-3-ylpyrazol-4-yl)-N-[(1-piperidin-1-ylcyclohexyl)methyl]methanamine |
| SMILES | Cn1cc(CNCC2(N3CCCCC3)CCCCC2)c(-c2cccnc2)n1 |
| InChI | InChI=1S/C22H33N5/c1-26-17-20(21(25-26)19-9-8-12-23-15-19)16-24-18-22(10-4-2-5-11-22)27-13-6-3-7-14-27/h8-9,12,15,17,24H,2-7,10-11,13-14,16,18H2,1H3 |
| InChIKey | UVBYVYSIGUYFIR-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.54 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |