About [1-[5-[[(2-methyl-1,3-thiazol-4-yl)methylamino]methyl]-2-pyridinyl]piperidin-4-yl]methanol
[1-[5-[[(2-methyl-1,3-thiazol-4-yl)methylamino]methyl]-2-pyridinyl]piperidin-4-yl]methanol (PubChem CID 47625933) has the molecular formula C17H24N4OS
and a molecular weight of 332.47 g/mol. Its IUPAC name is [1-[5-[[(2-methyl-1,3-thiazol-4-yl)methylamino]methyl]-2-pyridinyl]piperidin-4-yl]methanol.
Molecular Properties
| Compound Name | [1-[5-[[(2-methyl-1,3-thiazol-4-yl)methylamino]methyl]-2-pyridinyl]piperidin-4-yl]methanol |
| PubChem CID | 47625933 |
| Molecular Formula | C17H24N4OS |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | [1-[5-[[(2-methyl-1,3-thiazol-4-yl)methylamino]methyl]-2-pyridinyl]piperidin-4-yl]methanol |
| SMILES | Cc1nc(CNCc2ccc(N3CCC(CO)CC3)nc2)cs1 |
| InChI | InChI=1S/C17H24N4OS/c1-13-20-16(12-23-13)10-18-8-15-2-3-17(19-9-15)21-6-4-14(11-22)5-7-21/h2-3,9,12,14,18,22H,4-8,10-11H2,1H3 |
| InChIKey | REYUSHOXTSDPKU-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [1-[5-[[(2-methyl-1,3-thiazol-4-yl)methylamino]methyl]-2-pyridinyl]piperidin-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[5-[[(2-methyl-1,3-thiazol-4-yl)methylamino]methyl]-2-pyridinyl]piperidin-4-yl]methanol?
The IUPAC name of [1-[5-[[(2-methyl-1,3-thiazol-4-yl)methylamino]methyl]-2-pyridinyl]piperidin-4-yl]methanol (CID 47625933) is [1-[5-[[(2-methyl-1,3-thiazol-4-yl)methylamino]methyl]-2-pyridinyl]piperidin-4-yl]methanol.
What is the SMILES notation for [1-[5-[[(2-methyl-1,3-thiazol-4-yl)methylamino]methyl]-2-pyridinyl]piperidin-4-yl]methanol?
The canonical SMILES for [1-[5-[[(2-methyl-1,3-thiazol-4-yl)methylamino]methyl]-2-pyridinyl]piperidin-4-yl]methanol is Cc1nc(CNCc2ccc(N3CCC(CO)CC3)nc2)cs1.
What is the InChIKey of [1-[5-[[(2-methyl-1,3-thiazol-4-yl)methylamino]methyl]-2-pyridinyl]piperidin-4-yl]methanol?
The InChIKey is REYUSHOXTSDPKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N4OS/c1-13-20-16(12-23-13)10-18-8-15-2-3-17(19-9-15)21-6-4-14(11-22)5-7-21/h2-3,9,12,14,18,22H,4-8,10-11H2,1H3.
What are the key properties of [1-[5-[[(2-methyl-1,3-thiazol-4-yl)methylamino]methyl]-2-pyridinyl]piperidin-4-yl]methanol?
[1-[5-[[(2-methyl-1,3-thiazol-4-yl)methylamino]methyl]-2-pyridinyl]piperidin-4-yl]methanol has a molecular weight of 332.47 g/mol, XLogP of 2.35, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[5-[[(2-methyl-1,3-thiazol-4-yl)methylamino]methyl]-2-pyridinyl]piperidin-4-yl]methanol is sourced from PubChem (CID 47625933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).