C17H10ClNO3S — CID 4763223
4-[[3-(3-chlorophenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]benzaldehyde (PubChem CID 4763223) has the molecular formula C17H10ClNO3S and a molecular weight of 343.79 g/mol. Its IUPAC name is 4-[[3-(3-chlorophenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]benzaldehyde.
| Compound Name | 4-[[3-(3-chlorophenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]benzaldehyde |
|---|---|
| PubChem CID | 4763223 |
| Molecular Formula | C17H10ClNO3S |
| Molecular Weight | 343.79 g/mol |
| Exact Mass | 343.01 |
| IUPAC Name | 4-[[3-(3-chlorophenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]benzaldehyde |
| SMILES | O=Cc1ccc(C=C2SC(=O)N(c3cccc(Cl)c3)C2=O)cc1 |
| InChI | InChI=1S/C17H10ClNO3S/c18-13-2-1-3-14(9-13)19-16(21)15(23-17(19)22)8-11-4-6-12(10-20)7-5-11/h1-10H |
| InChIKey | KEQAAOFPPDIOSN-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.79 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|