About [3-acetyl-2-(4-fluorophenyl)imino-1,3-thiazol-4-yl] acetate
[3-acetyl-2-(4-fluorophenyl)imino-1,3-thiazol-4-yl] acetate (PubChem CID 4763495) has the molecular formula C13H11FN2O3S
and a molecular weight of 294.31 g/mol. Its IUPAC name is [3-acetyl-2-(4-fluorophenyl)imino-1,3-thiazol-4-yl] acetate.
Molecular Properties
| Compound Name | [3-acetyl-2-(4-fluorophenyl)imino-1,3-thiazol-4-yl] acetate |
| PubChem CID | 4763495 |
| Molecular Formula | C13H11FN2O3S |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | [3-acetyl-2-(4-fluorophenyl)imino-1,3-thiazol-4-yl] acetate |
| SMILES | CC(=O)Oc1cs/c(=N\c2ccc(F)cc2)n1C(C)=O |
| InChI | InChI=1S/C13H11FN2O3S/c1-8(17)16-12(19-9(2)18)7-20-13(16)15-11-5-3-10(14)4-6-11/h3-7H,1-2H3/b15-13- |
| InChIKey | VGXBWKDNZONQQB-SQFISAMPSA-N |
| XLogP | 2.51 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [3-acetyl-2-(4-fluorophenyl)imino-1,3-thiazol-4-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-acetyl-2-(4-fluorophenyl)imino-1,3-thiazol-4-yl] acetate?
The IUPAC name of [3-acetyl-2-(4-fluorophenyl)imino-1,3-thiazol-4-yl] acetate (CID 4763495) is [3-acetyl-2-(4-fluorophenyl)imino-1,3-thiazol-4-yl] acetate.
What is the SMILES notation for [3-acetyl-2-(4-fluorophenyl)imino-1,3-thiazol-4-yl] acetate?
The canonical SMILES for [3-acetyl-2-(4-fluorophenyl)imino-1,3-thiazol-4-yl] acetate is CC(=O)Oc1cs/c(=N\c2ccc(F)cc2)n1C(C)=O.
What is the InChIKey of [3-acetyl-2-(4-fluorophenyl)imino-1,3-thiazol-4-yl] acetate?
The InChIKey is VGXBWKDNZONQQB-SQFISAMPSA-N. The full InChI is InChI=1S/C13H11FN2O3S/c1-8(17)16-12(19-9(2)18)7-20-13(16)15-11-5-3-10(14)4-6-11/h3-7H,1-2H3/b15-13-.
What are the key properties of [3-acetyl-2-(4-fluorophenyl)imino-1,3-thiazol-4-yl] acetate?
[3-acetyl-2-(4-fluorophenyl)imino-1,3-thiazol-4-yl] acetate has a molecular weight of 294.31 g/mol, XLogP of 2.51, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-acetyl-2-(4-fluorophenyl)imino-1,3-thiazol-4-yl] acetate is sourced from PubChem (CID 4763495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).