About Naftifine
Naftifine (PubChem CID 47641) has the molecular formula C21H21N
and a molecular weight of 287.40 g/mol. Its IUPAC name is (E)-N-methyl-N-(naphthalen-1-ylmethyl)-3-phenylprop-2-en-1-amine.
Molecular Properties
| Compound Name | Naftifine |
| PubChem CID | 47641 |
| Molecular Formula | C21H21N |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | (E)-N-methyl-N-(naphthalen-1-ylmethyl)-3-phenylprop-2-en-1-amine |
| SMILES | CN(C/C=C/C1=CC=CC=C1)CC2=CC=CC3=CC=CC=C32 |
| InChI | InChI=1S/C21H21N/c1-22(16-8-11-18-9-3-2-4-10-18)17-20-14-7-13-19-12-5-6-15-21(19)20/h2-15H,16-17H2,1H3/b11-8+ |
| InChIKey | OZGNYLLQHRPOBR-DHZHZOJOSA-N |
| XLogP | 5.10 |
| TPSA | 3.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | 342 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze Naftifine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Naftifine?
The IUPAC name of Naftifine (CID 47641) is (E)-N-methyl-N-(naphthalen-1-ylmethyl)-3-phenylprop-2-en-1-amine.
What is the SMILES notation for Naftifine?
The canonical SMILES for Naftifine is CN(C/C=C/C1=CC=CC=C1)CC2=CC=CC3=CC=CC=C32.
What is the InChIKey of Naftifine?
The InChIKey is OZGNYLLQHRPOBR-DHZHZOJOSA-N. The full InChI is InChI=1S/C21H21N/c1-22(16-8-11-18-9-3-2-4-10-18)17-20-14-7-13-19-12-5-6-15-21(19)20/h2-15H,16-17H2,1H3/b11-8+.
What are the key properties of Naftifine?
Naftifine has a molecular weight of 287.40 g/mol, XLogP of 5.10, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Naftifine is sourced from PubChem (CID 47641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).