About 4-chloro-3-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)diazenyl]benzoic acid
4-chloro-3-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)diazenyl]benzoic acid (PubChem CID 4764242) has the molecular formula C11H7ClN4O5
and a molecular weight of 310.65 g/mol. Its IUPAC name is 4-chloro-3-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)diazenyl]benzoic acid.
Molecular Properties
| Compound Name | 4-chloro-3-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)diazenyl]benzoic acid |
| PubChem CID | 4764242 |
| Molecular Formula | C11H7ClN4O5 |
| Molecular Weight | 310.65 g/mol |
| Exact Mass | 310.01 |
| IUPAC Name | 4-chloro-3-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)diazenyl]benzoic acid |
| SMILES | O=C(O)c1ccc(Cl)c(/N=N/c2c(O)[nH]c(=O)[nH]c2=O)c1 |
| InChI | InChI=1S/C11H7ClN4O5/c12-5-2-1-4(10(19)20)3-6(5)15-16-7-8(17)13-11(21)14-9(7)18/h1-3H,(H,19,20)(H3,13,14,17,18,21)/b16-15+ |
| InChIKey | LREHKBZHNIPUGH-FOCLMDBBSA-N |
| XLogP | 1.54 |
| TPSA | 147.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.65 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-3-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)diazenyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-3-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)diazenyl]benzoic acid?
The IUPAC name of 4-chloro-3-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)diazenyl]benzoic acid (CID 4764242) is 4-chloro-3-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)diazenyl]benzoic acid.
What is the SMILES notation for 4-chloro-3-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)diazenyl]benzoic acid?
The canonical SMILES for 4-chloro-3-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)diazenyl]benzoic acid is O=C(O)c1ccc(Cl)c(/N=N/c2c(O)[nH]c(=O)[nH]c2=O)c1.
What is the InChIKey of 4-chloro-3-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)diazenyl]benzoic acid?
The InChIKey is LREHKBZHNIPUGH-FOCLMDBBSA-N. The full InChI is InChI=1S/C11H7ClN4O5/c12-5-2-1-4(10(19)20)3-6(5)15-16-7-8(17)13-11(21)14-9(7)18/h1-3H,(H,19,20)(H3,13,14,17,18,21)/b16-15+.
What are the key properties of 4-chloro-3-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)diazenyl]benzoic acid?
4-chloro-3-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)diazenyl]benzoic acid has a molecular weight of 310.65 g/mol, XLogP of 1.54, 3 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-3-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)diazenyl]benzoic acid is sourced from PubChem (CID 4764242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).