C27H20BrN3O5S — CID 4765734
4-[[5-[[2-bromo-4-[(2-cyanophenyl)methoxy]-5-methoxyphenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid (PubChem CID 4765734) has the molecular formula C27H20BrN3O5S and a molecular weight of 578.44 g/mol. Its IUPAC name is 4-[[5-[[2-bromo-4-[(2-cyanophenyl)methoxy]-5-methoxyphenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid.
| Compound Name | 4-[[5-[[2-bromo-4-[(2-cyanophenyl)methoxy]-5-methoxyphenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
|---|---|
| PubChem CID | 4765734 |
| Molecular Formula | C27H20BrN3O5S |
| Molecular Weight | 578.44 g/mol |
| Exact Mass | 577.03 |
| IUPAC Name | 4-[[5-[[2-bromo-4-[(2-cyanophenyl)methoxy]-5-methoxyphenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
| SMILES | COc1cc(C=C2S/C(=N/c3ccc(C(=O)O)cc3)N(C)C2=O)c(Br)cc1OCc1ccccc1C#N |
| InChI | InChI=1S/C27H20BrN3O5S/c1-31-25(32)24(37-27(31)30-20-9-7-16(8-10-20)26(33)34)12-19-11-22(35-2)23(13-21(19)28)36-15-18-6-4-3-5-17(18)14-29/h3-13H,15H2,1-2H3,(H,33,34)/b24-12?,30-27+ |
| InChIKey | JAWCOZWJBGTVHZ-CDVZFPRVSA-N |
| XLogP | 5.84 |
| TPSA | 112.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.44 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|