About (2-bromo-4-formylphenyl) 4-chlorobenzoate
(2-bromo-4-formylphenyl) 4-chlorobenzoate (PubChem CID 4766641) has the molecular formula C14H8BrClO3
and a molecular weight of 339.57 g/mol. Its IUPAC name is (2-bromo-4-formylphenyl) 4-chlorobenzoate.
Molecular Properties
| Compound Name | (2-bromo-4-formylphenyl) 4-chlorobenzoate |
| PubChem CID | 4766641 |
| Molecular Formula | C14H8BrClO3 |
| Molecular Weight | 339.57 g/mol |
| Exact Mass | 337.93 |
| IUPAC Name | (2-bromo-4-formylphenyl) 4-chlorobenzoate |
| SMILES | O=Cc1ccc(OC(=O)c2ccc(Cl)cc2)c(Br)c1 |
| InChI | InChI=1S/C14H8BrClO3/c15-12-7-9(8-17)1-6-13(12)19-14(18)10-2-4-11(16)5-3-10/h1-8H |
| InChIKey | WREJTLDPPCTXHQ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.57 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-bromo-4-formylphenyl) 4-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-bromo-4-formylphenyl) 4-chlorobenzoate?
The IUPAC name of (2-bromo-4-formylphenyl) 4-chlorobenzoate (CID 4766641) is (2-bromo-4-formylphenyl) 4-chlorobenzoate.
What is the SMILES notation for (2-bromo-4-formylphenyl) 4-chlorobenzoate?
The canonical SMILES for (2-bromo-4-formylphenyl) 4-chlorobenzoate is O=Cc1ccc(OC(=O)c2ccc(Cl)cc2)c(Br)c1.
What is the InChIKey of (2-bromo-4-formylphenyl) 4-chlorobenzoate?
The InChIKey is WREJTLDPPCTXHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8BrClO3/c15-12-7-9(8-17)1-6-13(12)19-14(18)10-2-4-11(16)5-3-10/h1-8H.
What are the key properties of (2-bromo-4-formylphenyl) 4-chlorobenzoate?
(2-bromo-4-formylphenyl) 4-chlorobenzoate has a molecular weight of 339.57 g/mol, XLogP of 4.13, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-bromo-4-formylphenyl) 4-chlorobenzoate is sourced from PubChem (CID 4766641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).