C30H34ClNO4 — CID 4766818
methyl 4-[3-[(4-chloro-2-methylphenoxy)methyl]-2,5-dimethylphenyl]-2,7,7-trimethyl-5-oxo-1,4,6,8-tetrahydroquinoline-3-carboxylate (PubChem CID 4766818) has the molecular formula C30H34ClNO4 and a molecular weight of 508.06 g/mol. Its IUPAC name is methyl 4-[3-[(4-chloro-2-methylphenoxy)methyl]-2,5-dimethylphenyl]-2,7,7-trimethyl-5-oxo-1,4,6,8-tetrahydroquinoline-3-carboxylate.
| Compound Name | methyl 4-[3-[(4-chloro-2-methylphenoxy)methyl]-2,5-dimethylphenyl]-2,7,7-trimethyl-5-oxo-1,4,6,8-tetrahydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 4766818 |
| Molecular Formula | C30H34ClNO4 |
| Molecular Weight | 508.06 g/mol |
| Exact Mass | 507.22 |
| IUPAC Name | methyl 4-[3-[(4-chloro-2-methylphenoxy)methyl]-2,5-dimethylphenyl]-2,7,7-trimethyl-5-oxo-1,4,6,8-tetrahydroquinoline-3-carboxylate |
| SMILES | COC(=O)C1=C(C)NC2=C(C(=O)CC(C)(C)C2)C1c1cc(C)cc(COc2ccc(Cl)cc2C)c1C |
| InChI | InChI=1S/C30H34ClNO4/c1-16-10-20(15-36-25-9-8-21(31)12-17(25)2)18(3)22(11-16)27-26(29(34)35-7)19(4)32-23-13-30(5,6)14-24(33)28(23)27/h8-12,27,32H,13-15H2,1-7H3 |
| InChIKey | VPPCSJUGQJHNMM-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.06 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |