About tert-butyl 4-[(1,3,5-trimethylpyrazol-4-yl)methyl]piperazine-1-carboxylate
tert-butyl 4-[(1,3,5-trimethylpyrazol-4-yl)methyl]piperazine-1-carboxylate (PubChem CID 4766952) has the molecular formula C16H28N4O2
and a molecular weight of 308.43 g/mol. Its IUPAC name is tert-butyl 4-[(1,3,5-trimethylpyrazol-4-yl)methyl]piperazine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-[(1,3,5-trimethylpyrazol-4-yl)methyl]piperazine-1-carboxylate |
| PubChem CID | 4766952 |
| Molecular Formula | C16H28N4O2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | tert-butyl 4-[(1,3,5-trimethylpyrazol-4-yl)methyl]piperazine-1-carboxylate |
| SMILES | Cc1nn(C)c(C)c1CN1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C16H28N4O2/c1-12-14(13(2)18(6)17-12)11-19-7-9-20(10-8-19)15(21)22-16(3,4)5/h7-11H2,1-6H3 |
| InChIKey | LFBHNSSCHPCGDF-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl 4-[(1,3,5-trimethylpyrazol-4-yl)methyl]piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-[(1,3,5-trimethylpyrazol-4-yl)methyl]piperazine-1-carboxylate?
The IUPAC name of tert-butyl 4-[(1,3,5-trimethylpyrazol-4-yl)methyl]piperazine-1-carboxylate (CID 4766952) is tert-butyl 4-[(1,3,5-trimethylpyrazol-4-yl)methyl]piperazine-1-carboxylate.
What is the SMILES notation for tert-butyl 4-[(1,3,5-trimethylpyrazol-4-yl)methyl]piperazine-1-carboxylate?
The canonical SMILES for tert-butyl 4-[(1,3,5-trimethylpyrazol-4-yl)methyl]piperazine-1-carboxylate is Cc1nn(C)c(C)c1CN1CCN(C(=O)OC(C)(C)C)CC1.
What is the InChIKey of tert-butyl 4-[(1,3,5-trimethylpyrazol-4-yl)methyl]piperazine-1-carboxylate?
The InChIKey is LFBHNSSCHPCGDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28N4O2/c1-12-14(13(2)18(6)17-12)11-19-7-9-20(10-8-19)15(21)22-16(3,4)5/h7-11H2,1-6H3.
What are the key properties of tert-butyl 4-[(1,3,5-trimethylpyrazol-4-yl)methyl]piperazine-1-carboxylate?
tert-butyl 4-[(1,3,5-trimethylpyrazol-4-yl)methyl]piperazine-1-carboxylate has a molecular weight of 308.43 g/mol, XLogP of 2.09, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-[(1,3,5-trimethylpyrazol-4-yl)methyl]piperazine-1-carboxylate is sourced from PubChem (CID 4766952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).