C13H20N6O4 — CID 4767395
2-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)amino]acetic acid (PubChem CID 4767395) has the molecular formula C13H20N6O4 and a molecular weight of 324.34 g/mol. Its IUPAC name is 2-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)amino]acetic acid.
| Compound Name | 2-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)amino]acetic acid |
|---|---|
| PubChem CID | 4767395 |
| Molecular Formula | C13H20N6O4 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 2-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)amino]acetic acid |
| SMILES | O=C(O)CNc1nc(N2CCOCC2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C13H20N6O4/c20-10(21)9-14-11-15-12(18-1-5-22-6-2-18)17-13(16-11)19-3-7-23-8-4-19/h1-9H2,(H,20,21)(H,14,15,16,17) |
| InChIKey | KYLZYTCXWADIMN-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 112.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |