About 1-cyclopropyl-3-(1,3-dimethylpyrazol-4-yl)thiourea
1-cyclopropyl-3-(1,3-dimethylpyrazol-4-yl)thiourea (PubChem CID 4767640) has the molecular formula C9H14N4S
and a molecular weight of 210.31 g/mol. Its IUPAC name is 1-cyclopropyl-3-(1,3-dimethylpyrazol-4-yl)thiourea.
Molecular Properties
| Compound Name | 1-cyclopropyl-3-(1,3-dimethylpyrazol-4-yl)thiourea |
| PubChem CID | 4767640 |
| Molecular Formula | C9H14N4S |
| Molecular Weight | 210.31 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 1-cyclopropyl-3-(1,3-dimethylpyrazol-4-yl)thiourea |
| SMILES | Cc1nn(C)cc1NC(=S)NC1CC1 |
| InChI | InChI=1S/C9H14N4S/c1-6-8(5-13(2)12-6)11-9(14)10-7-3-4-7/h5,7H,3-4H2,1-2H3,(H2,10,11,14) |
| InChIKey | GVNXSVHRNJEUCK-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.31 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclopropyl-3-(1,3-dimethylpyrazol-4-yl)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-3-(1,3-dimethylpyrazol-4-yl)thiourea?
The IUPAC name of 1-cyclopropyl-3-(1,3-dimethylpyrazol-4-yl)thiourea (CID 4767640) is 1-cyclopropyl-3-(1,3-dimethylpyrazol-4-yl)thiourea.
What is the SMILES notation for 1-cyclopropyl-3-(1,3-dimethylpyrazol-4-yl)thiourea?
The canonical SMILES for 1-cyclopropyl-3-(1,3-dimethylpyrazol-4-yl)thiourea is Cc1nn(C)cc1NC(=S)NC1CC1.
What is the InChIKey of 1-cyclopropyl-3-(1,3-dimethylpyrazol-4-yl)thiourea?
The InChIKey is GVNXSVHRNJEUCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N4S/c1-6-8(5-13(2)12-6)11-9(14)10-7-3-4-7/h5,7H,3-4H2,1-2H3,(H2,10,11,14).
What are the key properties of 1-cyclopropyl-3-(1,3-dimethylpyrazol-4-yl)thiourea?
1-cyclopropyl-3-(1,3-dimethylpyrazol-4-yl)thiourea has a molecular weight of 210.31 g/mol, XLogP of 1.18, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-3-(1,3-dimethylpyrazol-4-yl)thiourea is sourced from PubChem (CID 4767640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).