About N-(oxolan-2-ylmethyl)-3,4-dihydro-1H-isoquinoline-2-carbothioamide
N-(oxolan-2-ylmethyl)-3,4-dihydro-1H-isoquinoline-2-carbothioamide (PubChem CID 4767732) has the molecular formula C15H20N2OS
and a molecular weight of 276.40 g/mol. Its IUPAC name is N-(oxolan-2-ylmethyl)-3,4-dihydro-1H-isoquinoline-2-carbothioamide.
Molecular Properties
| Compound Name | N-(oxolan-2-ylmethyl)-3,4-dihydro-1H-isoquinoline-2-carbothioamide |
| PubChem CID | 4767732 |
| Molecular Formula | C15H20N2OS |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | N-(oxolan-2-ylmethyl)-3,4-dihydro-1H-isoquinoline-2-carbothioamide |
| SMILES | S=C(NCC1CCCO1)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C15H20N2OS/c19-15(16-10-14-6-3-9-18-14)17-8-7-12-4-1-2-5-13(12)11-17/h1-2,4-5,14H,3,6-11H2,(H,16,19) |
| InChIKey | DJFDFIABNOVDIR-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-(oxolan-2-ylmethyl)-3,4-dihydro-1H-isoquinoline-2-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(oxolan-2-ylmethyl)-3,4-dihydro-1H-isoquinoline-2-carbothioamide?
The IUPAC name of N-(oxolan-2-ylmethyl)-3,4-dihydro-1H-isoquinoline-2-carbothioamide (CID 4767732) is N-(oxolan-2-ylmethyl)-3,4-dihydro-1H-isoquinoline-2-carbothioamide.
What is the SMILES notation for N-(oxolan-2-ylmethyl)-3,4-dihydro-1H-isoquinoline-2-carbothioamide?
The canonical SMILES for N-(oxolan-2-ylmethyl)-3,4-dihydro-1H-isoquinoline-2-carbothioamide is S=C(NCC1CCCO1)N1CCc2ccccc2C1.
What is the InChIKey of N-(oxolan-2-ylmethyl)-3,4-dihydro-1H-isoquinoline-2-carbothioamide?
The InChIKey is DJFDFIABNOVDIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2OS/c19-15(16-10-14-6-3-9-18-14)17-8-7-12-4-1-2-5-13(12)11-17/h1-2,4-5,14H,3,6-11H2,(H,16,19).
What are the key properties of N-(oxolan-2-ylmethyl)-3,4-dihydro-1H-isoquinoline-2-carbothioamide?
N-(oxolan-2-ylmethyl)-3,4-dihydro-1H-isoquinoline-2-carbothioamide has a molecular weight of 276.40 g/mol, XLogP of 2.10, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(oxolan-2-ylmethyl)-3,4-dihydro-1H-isoquinoline-2-carbothioamide is sourced from PubChem (CID 4767732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).