C15H20BrF3N4O — CID 4769272
1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-3-[4-bromo-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propan-1-one (PubChem CID 4769272) has the molecular formula C15H20BrF3N4O and a molecular weight of 409.25 g/mol. Its IUPAC name is 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-3-[4-bromo-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propan-1-one.
| Compound Name | 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-3-[4-bromo-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propan-1-one |
|---|---|
| PubChem CID | 4769272 |
| Molecular Formula | C15H20BrF3N4O |
| Molecular Weight | 409.25 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-3-[4-bromo-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propan-1-one |
| SMILES | Cc1c(Br)c(C(F)(F)F)nn1CCC(=O)N1CCN2CCCC2C1 |
| InChI | InChI=1S/C15H20BrF3N4O/c1-10-13(16)14(15(17,18)19)20-23(10)6-4-12(24)22-8-7-21-5-2-3-11(21)9-22/h11H,2-9H2,1H3 |
| InChIKey | DQDRMGNXMWVQSW-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.25 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |