C17H22F3N3O — CID 4770268
N-(1-adamantylmethyl)-1-methyl-5-(trifluoromethyl)pyrazole-3-carboxamide (PubChem CID 4770268) has the molecular formula C17H22F3N3O and a molecular weight of 341.38 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-1-methyl-5-(trifluoromethyl)pyrazole-3-carboxamide.
| Compound Name | N-(1-adamantylmethyl)-1-methyl-5-(trifluoromethyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 4770268 |
| Molecular Formula | C17H22F3N3O |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | N-(1-adamantylmethyl)-1-methyl-5-(trifluoromethyl)pyrazole-3-carboxamide |
| SMILES | Cn1nc(C(=O)NCC23CC4CC(CC(C4)C2)C3)cc1C(F)(F)F |
| InChI | InChI=1S/C17H22F3N3O/c1-23-14(17(18,19)20)5-13(22-23)15(24)21-9-16-6-10-2-11(7-16)4-12(3-10)8-16/h5,10-12H,2-4,6-9H2,1H3,(H,21,24) |
| InChIKey | RENFLFZKPACOPG-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |