C13H16N6O — CID 4770296
(2-methylpyrazol-3-yl)-(4-pyrimidin-2-ylpiperazin-1-yl)methanone (PubChem CID 4770296) has the molecular formula C13H16N6O and a molecular weight of 272.31 g/mol. Its IUPAC name is (2-methylpyrazol-3-yl)-(4-pyrimidin-2-ylpiperazin-1-yl)methanone.
| Compound Name | (2-methylpyrazol-3-yl)-(4-pyrimidin-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 4770296 |
| Molecular Formula | C13H16N6O |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | (2-methylpyrazol-3-yl)-(4-pyrimidin-2-ylpiperazin-1-yl)methanone |
| SMILES | Cn1nccc1C(=O)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C13H16N6O/c1-17-11(3-6-16-17)12(20)18-7-9-19(10-8-18)13-14-4-2-5-15-13/h2-6H,7-10H2,1H3 |
| InChIKey | AMUWEFTTYMNCGB-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |