C10H7N3O2S2 — CID 4770387
1,1-dioxo-N-(1,3-thiazol-2-yl)-1,2-benzothiazol-3-amine (PubChem CID 4770387) has the molecular formula C10H7N3O2S2 and a molecular weight of 265.32 g/mol. Its IUPAC name is 1,1-dioxo-N-(1,3-thiazol-2-yl)-1,2-benzothiazol-3-amine.
| Compound Name | 1,1-dioxo-N-(1,3-thiazol-2-yl)-1,2-benzothiazol-3-amine |
|---|---|
| PubChem CID | 4770387 |
| Molecular Formula | C10H7N3O2S2 |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.00 |
| IUPAC Name | 1,1-dioxo-N-(1,3-thiazol-2-yl)-1,2-benzothiazol-3-amine |
| SMILES | O=S1(=O)N=C(Nc2nccs2)c2ccccc21 |
| InChI | InChI=1S/C10H7N3O2S2/c14-17(15)8-4-2-1-3-7(8)9(13-17)12-10-11-5-6-16-10/h1-6H,(H,11,12,13) |
| InChIKey | CXVPWFJNMUSAHK-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |