C10H16BrN3O — CID 4770548
4-bromo-N,N,1-triethylpyrazole-5-carboxamide (PubChem CID 4770548) has the molecular formula C10H16BrN3O and a molecular weight of 274.16 g/mol. Its IUPAC name is 4-bromo-N,N,1-triethylpyrazole-5-carboxamide.
| Compound Name | 4-bromo-N,N,1-triethylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 4770548 |
| Molecular Formula | C10H16BrN3O |
| Molecular Weight | 274.16 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | 4-bromo-N,N,1-triethylpyrazole-5-carboxamide |
| SMILES | CCN(CC)C(=O)c1c(Br)cnn1CC |
| InChI | InChI=1S/C10H16BrN3O/c1-4-13(5-2)10(15)9-8(11)7-12-14(9)6-3/h7H,4-6H2,1-3H3 |
| InChIKey | JYFQGDPNFMILFW-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.16 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |