About 2-(4-bromo-5-methylpyrazol-1-yl)-N-(5-methyl-1,2-oxazol-3-yl)acetamide
2-(4-bromo-5-methylpyrazol-1-yl)-N-(5-methyl-1,2-oxazol-3-yl)acetamide (PubChem CID 4770837) has the molecular formula C10H11BrN4O2
and a molecular weight of 299.13 g/mol. Its IUPAC name is 2-(4-bromo-5-methylpyrazol-1-yl)-N-(5-methyl-1,2-oxazol-3-yl)acetamide.
Molecular Properties
| Compound Name | 2-(4-bromo-5-methylpyrazol-1-yl)-N-(5-methyl-1,2-oxazol-3-yl)acetamide |
| PubChem CID | 4770837 |
| Molecular Formula | C10H11BrN4O2 |
| Molecular Weight | 299.13 g/mol |
| Exact Mass | 298.01 |
| IUPAC Name | 2-(4-bromo-5-methylpyrazol-1-yl)-N-(5-methyl-1,2-oxazol-3-yl)acetamide |
| SMILES | Cc1cc(NC(=O)Cn2ncc(Br)c2C)no1 |
| InChI | InChI=1S/C10H11BrN4O2/c1-6-3-9(14-17-6)13-10(16)5-15-7(2)8(11)4-12-15/h3-4H,5H2,1-2H3,(H,13,14,16) |
| InChIKey | IDUQHNLLQIAGKT-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.13 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(4-bromo-5-methylpyrazol-1-yl)-N-(5-methyl-1,2-oxazol-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromo-5-methylpyrazol-1-yl)-N-(5-methyl-1,2-oxazol-3-yl)acetamide?
The IUPAC name of 2-(4-bromo-5-methylpyrazol-1-yl)-N-(5-methyl-1,2-oxazol-3-yl)acetamide (CID 4770837) is 2-(4-bromo-5-methylpyrazol-1-yl)-N-(5-methyl-1,2-oxazol-3-yl)acetamide.
What is the SMILES notation for 2-(4-bromo-5-methylpyrazol-1-yl)-N-(5-methyl-1,2-oxazol-3-yl)acetamide?
The canonical SMILES for 2-(4-bromo-5-methylpyrazol-1-yl)-N-(5-methyl-1,2-oxazol-3-yl)acetamide is Cc1cc(NC(=O)Cn2ncc(Br)c2C)no1.
What is the InChIKey of 2-(4-bromo-5-methylpyrazol-1-yl)-N-(5-methyl-1,2-oxazol-3-yl)acetamide?
The InChIKey is IDUQHNLLQIAGKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11BrN4O2/c1-6-3-9(14-17-6)13-10(16)5-15-7(2)8(11)4-12-15/h3-4H,5H2,1-2H3,(H,13,14,16).
What are the key properties of 2-(4-bromo-5-methylpyrazol-1-yl)-N-(5-methyl-1,2-oxazol-3-yl)acetamide?
2-(4-bromo-5-methylpyrazol-1-yl)-N-(5-methyl-1,2-oxazol-3-yl)acetamide has a molecular weight of 299.13 g/mol, XLogP of 1.89, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromo-5-methylpyrazol-1-yl)-N-(5-methyl-1,2-oxazol-3-yl)acetamide is sourced from PubChem (CID 4770837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).