About 4-(4-methylpiperidin-1-yl)-1,2,5-thiadiazol-3-one
4-(4-methylpiperidin-1-yl)-1,2,5-thiadiazol-3-one (PubChem CID 4770992) has the molecular formula C8H13N3OS
and a molecular weight of 199.28 g/mol. Its IUPAC name is 4-(4-methylpiperidin-1-yl)-1,2,5-thiadiazol-3-one.
Molecular Properties
| Compound Name | 4-(4-methylpiperidin-1-yl)-1,2,5-thiadiazol-3-one |
| PubChem CID | 4770992 |
| Molecular Formula | C8H13N3OS |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 4-(4-methylpiperidin-1-yl)-1,2,5-thiadiazol-3-one |
| SMILES | CC1CCN(c2ns[nH]c2=O)CC1 |
| InChI | InChI=1S/C8H13N3OS/c1-6-2-4-11(5-3-6)7-8(12)10-13-9-7/h6H,2-5H2,1H3,(H,10,12) |
| InChIKey | IHFDLSPKEFNEFG-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(4-methylpiperidin-1-yl)-1,2,5-thiadiazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methylpiperidin-1-yl)-1,2,5-thiadiazol-3-one?
The IUPAC name of 4-(4-methylpiperidin-1-yl)-1,2,5-thiadiazol-3-one (CID 4770992) is 4-(4-methylpiperidin-1-yl)-1,2,5-thiadiazol-3-one.
What is the SMILES notation for 4-(4-methylpiperidin-1-yl)-1,2,5-thiadiazol-3-one?
The canonical SMILES for 4-(4-methylpiperidin-1-yl)-1,2,5-thiadiazol-3-one is CC1CCN(c2ns[nH]c2=O)CC1.
What is the InChIKey of 4-(4-methylpiperidin-1-yl)-1,2,5-thiadiazol-3-one?
The InChIKey is IHFDLSPKEFNEFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3OS/c1-6-2-4-11(5-3-6)7-8(12)10-13-9-7/h6H,2-5H2,1H3,(H,10,12).
What are the key properties of 4-(4-methylpiperidin-1-yl)-1,2,5-thiadiazol-3-one?
4-(4-methylpiperidin-1-yl)-1,2,5-thiadiazol-3-one has a molecular weight of 199.28 g/mol, XLogP of 1.07, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methylpiperidin-1-yl)-1,2,5-thiadiazol-3-one is sourced from PubChem (CID 4770992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).