methyl 4-(tetrazol-1-yl)benzoate

C9H8N4O2 — CID 4771133

IUPACmethyl 4-(tetrazol-1-yl)benzoate
SMILESCOC(=O)c1ccc(-n2cnnn2)cc1
InChIInChI=1S/C9H8N4O2/c1-15-9(14)7-2-4-8(5-3-7)13-6-10-11-12-13/h2-6H,1H3
InChIKeyWVKMMKCGEPFVTQ-UHFFFAOYSA-N
MW204.19 g/mol
LogP0.45
Rot. Bonds2

About methyl 4-(tetrazol-1-yl)benzoate

methyl 4-(tetrazol-1-yl)benzoate (PubChem CID 4771133) has the molecular formula C9H8N4O2 and a molecular weight of 204.19 g/mol. Its IUPAC name is methyl 4-(tetrazol-1-yl)benzoate.

Molecular Properties

Compound Namemethyl 4-(tetrazol-1-yl)benzoate
PubChem CID4771133
Molecular FormulaC9H8N4O2
Molecular Weight204.19 g/mol
Exact Mass204.06
IUPAC Namemethyl 4-(tetrazol-1-yl)benzoate
SMILESCOC(=O)c1ccc(-n2cnnn2)cc1
InChIInChI=1S/C9H8N4O2/c1-15-9(14)7-2-4-8(5-3-7)13-6-10-11-12-13/h2-6H,1H3
InChIKeyWVKMMKCGEPFVTQ-UHFFFAOYSA-N
XLogP0.45
TPSA69.90 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds2
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500204.19
LogP ≤ 50.45
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze methyl 4-(tetrazol-1-yl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-(tetrazol-1-yl)benzoate?
The IUPAC name of methyl 4-(tetrazol-1-yl)benzoate (CID 4771133) is methyl 4-(tetrazol-1-yl)benzoate.
What is the SMILES notation for methyl 4-(tetrazol-1-yl)benzoate?
The canonical SMILES for methyl 4-(tetrazol-1-yl)benzoate is COC(=O)c1ccc(-n2cnnn2)cc1.
What is the InChIKey of methyl 4-(tetrazol-1-yl)benzoate?
The InChIKey is WVKMMKCGEPFVTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N4O2/c1-15-9(14)7-2-4-8(5-3-7)13-6-10-11-12-13/h2-6H,1H3.
What are the key properties of methyl 4-(tetrazol-1-yl)benzoate?
methyl 4-(tetrazol-1-yl)benzoate has a molecular weight of 204.19 g/mol, XLogP of 0.45, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(tetrazol-1-yl)benzoate is sourced from PubChem (CID 4771133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).